C24H17F3N6O5 — CID 53496603
2-hydroxy-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2-[4-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]phenyl]acetamide (PubChem CID 53496603) has the molecular formula C24H17F3N6O5 and a molecular weight of 526.43 g/mol. Its IUPAC name is 2-hydroxy-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2-[4-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]phenyl]acetamide.
| Compound Name | 2-hydroxy-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2-[4-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 53496603 |
| Molecular Formula | C24H17F3N6O5 |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 2-hydroxy-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2-[4-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]phenyl]acetamide |
| SMILES | Cc1nnc(CNC(=O)C(O)c2ccc(-c3noc(-c4onc(-c5ccccc5)c4C(F)(F)F)n3)cc2)o1 |
| InChI | InChI=1S/C24H17F3N6O5/c1-12-30-31-16(36-12)11-28-22(35)19(34)14-7-9-15(10-8-14)21-29-23(38-33-21)20-17(24(25,26)27)18(32-37-20)13-5-3-2-4-6-13/h2-10,19,34H,11H2,1H3,(H,28,35) |
| InChIKey | DSVUBNIUZPSVHV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 153.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |