C21H32O2 — CID 53496761
(2S,4aS,10aR)-7-(2-methoxypropan-2-yl)-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-ol (PubChem CID 53496761) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (2S,4aS,10aR)-7-(2-methoxypropan-2-yl)-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-ol.
| Compound Name | (2S,4aS,10aR)-7-(2-methoxypropan-2-yl)-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 53496761 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (2S,4aS,10aR)-7-(2-methoxypropan-2-yl)-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-ol |
| SMILES | COC(C)(C)c1ccc2c(c1)CC[C@H]1C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C21H32O2/c1-19(2)17-10-7-14-13-15(20(3,4)23-6)8-9-16(14)21(17,5)12-11-18(19)22/h8-9,13,17-18,22H,7,10-12H2,1-6H3/t17-,18-,21+/m0/s1 |
| InChIKey | PLAWCHHGVYSNLQ-BBTUJRGHSA-N |
| XLogP | 4.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |