C22H40O8Si — CID 53497019
(2R,3R,4aR,8R,8aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-(ethoxymethoxy)-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-5-one (PubChem CID 53497019) has the molecular formula C22H40O8Si and a molecular weight of 460.64 g/mol. Its IUPAC name is (2R,3R,4aR,8R,8aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-(ethoxymethoxy)-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-5-one.
| Compound Name | (2R,3R,4aR,8R,8aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-(ethoxymethoxy)-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-5-one |
|---|---|
| PubChem CID | 53497019 |
| Molecular Formula | C22H40O8Si |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | (2R,3R,4aR,8R,8aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-(ethoxymethoxy)-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-5-one |
| SMILES | CCOCO[C@@H]1C(CO[Si](C)(C)C(C)(C)C)=CC(=O)[C@@H]2O[C@@](C)(OC)[C@](C)(OC)O[C@@H]12 |
| InChI | InChI=1S/C22H40O8Si/c1-11-26-14-27-17-15(13-28-31(9,10)20(2,3)4)12-16(23)18-19(17)30-22(6,25-8)21(5,24-7)29-18/h12,17-19H,11,13-14H2,1-10H3/t17-,18+,19+,21-,22-/m1/s1 |
| InChIKey | IZGZFSMUOHYHLH-YUQCVWRMSA-N |
| XLogP | 3.41 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|