C15H17NO9 — CID 53497338
trimethyl (3S,7aS)-3-acetyl-3-methyl-5-oxo-1H-pyrrolo[1,2-c][1,3]oxazole-6,7,7a-tricarboxylate (PubChem CID 53497338) has the molecular formula C15H17NO9 and a molecular weight of 355.30 g/mol. Its IUPAC name is trimethyl (3S,7aS)-3-acetyl-3-methyl-5-oxo-1H-pyrrolo[1,2-c][1,3]oxazole-6,7,7a-tricarboxylate.
| Compound Name | trimethyl (3S,7aS)-3-acetyl-3-methyl-5-oxo-1H-pyrrolo[1,2-c][1,3]oxazole-6,7,7a-tricarboxylate |
|---|---|
| PubChem CID | 53497338 |
| Molecular Formula | C15H17NO9 |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | trimethyl (3S,7aS)-3-acetyl-3-methyl-5-oxo-1H-pyrrolo[1,2-c][1,3]oxazole-6,7,7a-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]2(C(=O)OC)CO[C@@](C)(C(C)=O)N2C1=O |
| InChI | InChI=1S/C15H17NO9/c1-7(17)14(2)16-10(18)8(11(19)22-3)9(12(20)23-4)15(16,6-25-14)13(21)24-5/h6H2,1-5H3/t14-,15+/m0/s1 |
| InChIKey | ACMIKPYDJAZRKX-LSDHHAIUSA-N |
| XLogP | -1.28 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|