About N,N-diethyl-2,3-bis[(Z)-hexadec-9-enoxy]propan-1-amine
N,N-diethyl-2,3-bis[(Z)-hexadec-9-enoxy]propan-1-amine (PubChem CID 53497374) has the molecular formula C39H77NO2
and a molecular weight of 592.05 g/mol. Its IUPAC name is N,N-diethyl-2,3-bis[(Z)-hexadec-9-enoxy]propan-1-amine.
Molecular Properties
| Compound Name | N,N-diethyl-2,3-bis[(Z)-hexadec-9-enoxy]propan-1-amine |
| PubChem CID | 53497374 |
| Molecular Formula | C39H77NO2 |
| Molecular Weight | 592.05 g/mol |
| Exact Mass | 591.60 |
| IUPAC Name | N,N-diethyl-2,3-bis[(Z)-hexadec-9-enoxy]propan-1-amine |
| SMILES | CCCCCC/C=C\CCCCCCCCOCC(CN(CC)CC)OCCCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C39H77NO2/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-35-41-38-39(37-40(7-3)8-4)42-36-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2/h17-20,39H,5-16,21-38H2,1-4H3/b19-17-,20-18- |
| InChIKey | LJXHNSOZTMOZFS-CLFAGFIQSA-N |
| XLogP | 12.24 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.05 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-2,3-bis[(Z)-hexadec-9-enoxy]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2,3-bis[(Z)-hexadec-9-enoxy]propan-1-amine?
The IUPAC name of N,N-diethyl-2,3-bis[(Z)-hexadec-9-enoxy]propan-1-amine (CID 53497374) is N,N-diethyl-2,3-bis[(Z)-hexadec-9-enoxy]propan-1-amine.
What is the SMILES notation for N,N-diethyl-2,3-bis[(Z)-hexadec-9-enoxy]propan-1-amine?
The canonical SMILES for N,N-diethyl-2,3-bis[(Z)-hexadec-9-enoxy]propan-1-amine is CCCCCC/C=C\CCCCCCCCOCC(CN(CC)CC)OCCCCCCCC/C=C\CCCCCC.
What is the InChIKey of N,N-diethyl-2,3-bis[(Z)-hexadec-9-enoxy]propan-1-amine?
The InChIKey is LJXHNSOZTMOZFS-CLFAGFIQSA-N. The full InChI is InChI=1S/C39H77NO2/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-35-41-38-39(37-40(7-3)8-4)42-36-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2/h17-20,39H,5-16,21-38H2,1-4H3/b19-17-,20-18-.
What are the key properties of N,N-diethyl-2,3-bis[(Z)-hexadec-9-enoxy]propan-1-amine?
N,N-diethyl-2,3-bis[(Z)-hexadec-9-enoxy]propan-1-amine has a molecular weight of 592.05 g/mol, XLogP of 12.24, 35 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2,3-bis[(Z)-hexadec-9-enoxy]propan-1-amine is sourced from PubChem (CID 53497374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).