C24H17F7N4O2 — CID 53497377
2-(2,4-difluorophenyl)-1,1-difluoro-3-(1,2,4-triazol-1-yl)-1-[5-[4-(2,2,2-trifluoroethoxy)phenyl]-2-pyridinyl]propan-2-ol (PubChem CID 53497377) has the molecular formula C24H17F7N4O2 and a molecular weight of 526.41 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1,1-difluoro-3-(1,2,4-triazol-1-yl)-1-[5-[4-(2,2,2-trifluoroethoxy)phenyl]-2-pyridinyl]propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1,1-difluoro-3-(1,2,4-triazol-1-yl)-1-[5-[4-(2,2,2-trifluoroethoxy)phenyl]-2-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 53497377 |
| Molecular Formula | C24H17F7N4O2 |
| Molecular Weight | 526.41 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1,1-difluoro-3-(1,2,4-triazol-1-yl)-1-[5-[4-(2,2,2-trifluoroethoxy)phenyl]-2-pyridinyl]propan-2-ol |
| SMILES | OC(Cn1cncn1)(c1ccc(F)cc1F)C(F)(F)c1ccc(-c2ccc(OCC(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C24H17F7N4O2/c25-17-4-7-19(20(26)9-17)22(36,11-35-14-32-13-34-35)24(30,31)21-8-3-16(10-33-21)15-1-5-18(6-2-15)37-12-23(27,28)29/h1-10,13-14,36H,11-12H2 |
| InChIKey | MSRICOSVBSYAJO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |