C24H16F9N5O2 — CID 53497491
2-(2,4-difluorophenyl)-1,1-difluoro-1-[5-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]-2-pyridinyl]-3-(tetrazol-1-yl)propan-2-ol (PubChem CID 53497491) has the molecular formula C24H16F9N5O2 and a molecular weight of 577.41 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1,1-difluoro-1-[5-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]-2-pyridinyl]-3-(tetrazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1,1-difluoro-1-[5-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]-2-pyridinyl]-3-(tetrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 53497491 |
| Molecular Formula | C24H16F9N5O2 |
| Molecular Weight | 577.41 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1,1-difluoro-1-[5-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]-2-pyridinyl]-3-(tetrazol-1-yl)propan-2-ol |
| SMILES | OC(Cn1cnnn1)(c1ccc(F)cc1F)C(F)(F)c1ccc(-c2ccc(OCC(F)(F)C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C24H16F9N5O2/c25-16-4-7-18(19(26)9-16)21(39,11-38-13-35-36-37-38)23(29,30)20-8-3-15(10-34-20)14-1-5-17(6-2-14)40-12-22(27,28)24(31,32)33/h1-10,13,39H,11-12H2 |
| InChIKey | YTYDYXBYPZKLBW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|