C7H6F7NO — CID 534980
2,2,3,3,4,4,4-heptafluoro-N-prop-2-enylbutanamide (PubChem CID 534980) has the molecular formula C7H6F7NO and a molecular weight of 253.12 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-prop-2-enylbutanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-prop-2-enylbutanamide |
|---|---|
| PubChem CID | 534980 |
| Molecular Formula | C7H6F7NO |
| Molecular Weight | 253.12 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-prop-2-enylbutanamide |
| SMILES | C=CCNC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H6F7NO/c1-2-3-15-4(16)5(8,9)6(10,11)7(12,13)14/h2H,1,3H2,(H,15,16) |
| InChIKey | SKKPQHYWKCNHNB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.12 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|