About N-tert-butyl-2,4-dimethyl-1,3-thiazole-5-carboxamide
N-tert-butyl-2,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 53498235) has the molecular formula C10H16N2OS
and a molecular weight of 212.32 g/mol. Its IUPAC name is N-tert-butyl-2,4-dimethyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 53498235 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | N-tert-butyl-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)NC(C)(C)C)s1 |
| InChI | InChI=1S/C10H16N2OS/c1-6-8(14-7(2)11-6)9(13)12-10(3,4)5/h1-5H3,(H,12,13) |
| InChIKey | MWBJQZIPHWLQBI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-2,4-dimethyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,4-dimethyl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-tert-butyl-2,4-dimethyl-1,3-thiazole-5-carboxamide (CID 53498235) is N-tert-butyl-2,4-dimethyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-tert-butyl-2,4-dimethyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-tert-butyl-2,4-dimethyl-1,3-thiazole-5-carboxamide is Cc1nc(C)c(C(=O)NC(C)(C)C)s1.
What is the InChIKey of N-tert-butyl-2,4-dimethyl-1,3-thiazole-5-carboxamide?
The InChIKey is MWBJQZIPHWLQBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2OS/c1-6-8(14-7(2)11-6)9(13)12-10(3,4)5/h1-5H3,(H,12,13).
What are the key properties of N-tert-butyl-2,4-dimethyl-1,3-thiazole-5-carboxamide?
N-tert-butyl-2,4-dimethyl-1,3-thiazole-5-carboxamide has a molecular weight of 212.32 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,4-dimethyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 53498235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).