About 4-(4-methylpent-3-enyl)-3,6-dihydrodithiine
4-(4-methylpent-3-enyl)-3,6-dihydrodithiine (PubChem CID 534986) has the molecular formula C10H16S2
and a molecular weight of 200.37 g/mol. Its IUPAC name is 4-(4-methylpent-3-enyl)-3,6-dihydrodithiine.
Molecular Properties
| Compound Name | 4-(4-methylpent-3-enyl)-3,6-dihydrodithiine |
| PubChem CID | 534986 |
| Molecular Formula | C10H16S2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 4-(4-methylpent-3-enyl)-3,6-dihydrodithiine |
| SMILES | CC(C)=CCCC1=CCSSC1 |
| InChI | InChI=1S/C10H16S2/c1-9(2)4-3-5-10-6-7-11-12-8-10/h4,6H,3,5,7-8H2,1-2H3 |
| InChIKey | QQBNLTZXJHZJJD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methylpent-3-enyl)-3,6-dihydrodithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylpent-3-enyl)-3,6-dihydrodithiine?
The IUPAC name of 4-(4-methylpent-3-enyl)-3,6-dihydrodithiine (CID 534986) is 4-(4-methylpent-3-enyl)-3,6-dihydrodithiine.
What is the SMILES notation for 4-(4-methylpent-3-enyl)-3,6-dihydrodithiine?
The canonical SMILES for 4-(4-methylpent-3-enyl)-3,6-dihydrodithiine is CC(C)=CCCC1=CCSSC1.
What is the InChIKey of 4-(4-methylpent-3-enyl)-3,6-dihydrodithiine?
The InChIKey is QQBNLTZXJHZJJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16S2/c1-9(2)4-3-5-10-6-7-11-12-8-10/h4,6H,3,5,7-8H2,1-2H3.
What are the key properties of 4-(4-methylpent-3-enyl)-3,6-dihydrodithiine?
4-(4-methylpent-3-enyl)-3,6-dihydrodithiine has a molecular weight of 200.37 g/mol, XLogP of 4.05, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylpent-3-enyl)-3,6-dihydrodithiine is sourced from PubChem (CID 534986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).