C18H24N4O2 — CID 53498847
N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-N-methyl-2-(2,4,6-trimethylphenoxy)acetamide (PubChem CID 53498847) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-N-methyl-2-(2,4,6-trimethylphenoxy)acetamide.
| Compound Name | N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-N-methyl-2-(2,4,6-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 53498847 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-N-methyl-2-(2,4,6-trimethylphenoxy)acetamide |
| SMILES | Cc1cc(C)c(OCC(=O)N(C)Cc2nnc3n2CCC3)c(C)c1 |
| InChI | InChI=1S/C18H24N4O2/c1-12-8-13(2)18(14(3)9-12)24-11-17(23)21(4)10-16-20-19-15-6-5-7-22(15)16/h8-9H,5-7,10-11H2,1-4H3 |
| InChIKey | AGVCLRPYHGLRJR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |