C12H11Cl2N7 — CID 53498920
N'-(3,5-dichloro-2-pyridinyl)-N-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)ethane-1,2-diamine (PubChem CID 53498920) has the molecular formula C12H11Cl2N7 and a molecular weight of 324.18 g/mol. Its IUPAC name is N'-(3,5-dichloro-2-pyridinyl)-N-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)ethane-1,2-diamine.
| Compound Name | N'-(3,5-dichloro-2-pyridinyl)-N-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 53498920 |
| Molecular Formula | C12H11Cl2N7 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | N'-(3,5-dichloro-2-pyridinyl)-N-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)ethane-1,2-diamine |
| SMILES | Clc1cnc(NCCNc2ccc3nncn3n2)c(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2N7/c13-8-5-9(14)12(17-6-8)16-4-3-15-10-1-2-11-19-18-7-21(11)20-10/h1-2,5-7H,3-4H2,(H,15,20)(H,16,17) |
| InChIKey | DEYSMVRQSVROJG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 80.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|