About N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1-[2-(methoxymethyl)phenyl]methanamine
N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1-[2-(methoxymethyl)phenyl]methanamine (PubChem CID 53499067) has the molecular formula C18H22N4O
and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1-[2-(methoxymethyl)phenyl]methanamine.
Molecular Properties
| Compound Name | N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1-[2-(methoxymethyl)phenyl]methanamine |
| PubChem CID | 53499067 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1-[2-(methoxymethyl)phenyl]methanamine |
| SMILES | COCc1ccccc1CNCc1cnc2c(c1)c(C)nn2C |
| InChI | InChI=1S/C18H22N4O/c1-13-17-8-14(10-20-18(17)22(2)21-13)9-19-11-15-6-4-5-7-16(15)12-23-3/h4-8,10,19H,9,11-12H2,1-3H3 |
| InChIKey | IOXIOVAMBFTCHY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1-[2-(methoxymethyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1-[2-(methoxymethyl)phenyl]methanamine?
The IUPAC name of N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1-[2-(methoxymethyl)phenyl]methanamine (CID 53499067) is N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1-[2-(methoxymethyl)phenyl]methanamine.
What is the SMILES notation for N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1-[2-(methoxymethyl)phenyl]methanamine?
The canonical SMILES for N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1-[2-(methoxymethyl)phenyl]methanamine is COCc1ccccc1CNCc1cnc2c(c1)c(C)nn2C.
What is the InChIKey of N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1-[2-(methoxymethyl)phenyl]methanamine?
The InChIKey is IOXIOVAMBFTCHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O/c1-13-17-8-14(10-20-18(17)22(2)21-13)9-19-11-15-6-4-5-7-16(15)12-23-3/h4-8,10,19H,9,11-12H2,1-3H3.
What are the key properties of N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1-[2-(methoxymethyl)phenyl]methanamine?
N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1-[2-(methoxymethyl)phenyl]methanamine has a molecular weight of 310.40 g/mol, XLogP of 2.71, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1-[2-(methoxymethyl)phenyl]methanamine is sourced from PubChem (CID 53499067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).