C18H27N3O4 — CID 53499267
N-[2-[[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]carbamoylamino]ethyl]acetamide (PubChem CID 53499267) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-[2-[[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]carbamoylamino]ethyl]acetamide.
| Compound Name | N-[2-[[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]carbamoylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 53499267 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | N-[2-[[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]carbamoylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNC(=O)NC(c1ccc2c(c1)OCCCO2)C(C)C |
| InChI | InChI=1S/C18H27N3O4/c1-12(2)17(21-18(23)20-8-7-19-13(3)22)14-5-6-15-16(11-14)25-10-4-9-24-15/h5-6,11-12,17H,4,7-10H2,1-3H3,(H,19,22)(H2,20,21,23) |
| InChIKey | NLEVVULBPAUFMB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|