C16H20N4OS — CID 53499414
N-(pyridin-2-ylmethyl)-4-(thiophen-3-ylmethyl)piperazine-1-carboxamide (PubChem CID 53499414) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-4-(thiophen-3-ylmethyl)piperazine-1-carboxamide.
| Compound Name | N-(pyridin-2-ylmethyl)-4-(thiophen-3-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 53499414 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-4-(thiophen-3-ylmethyl)piperazine-1-carboxamide |
| SMILES | O=C(NCc1ccccn1)N1CCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C16H20N4OS/c21-16(18-11-15-3-1-2-5-17-15)20-8-6-19(7-9-20)12-14-4-10-22-13-14/h1-5,10,13H,6-9,11-12H2,(H,18,21) |
| InChIKey | NGQWULSHJJGPLJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |