C15H18N2O4 — CID 53499763
3-(2-oxo-1,3-benzoxazol-3-yl)-N-(oxolan-3-ylmethyl)propanamide (PubChem CID 53499763) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-(2-oxo-1,3-benzoxazol-3-yl)-N-(oxolan-3-ylmethyl)propanamide.
| Compound Name | 3-(2-oxo-1,3-benzoxazol-3-yl)-N-(oxolan-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 53499763 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-(2-oxo-1,3-benzoxazol-3-yl)-N-(oxolan-3-ylmethyl)propanamide |
| SMILES | O=C(CCn1c(=O)oc2ccccc21)NCC1CCOC1 |
| InChI | InChI=1S/C15H18N2O4/c18-14(16-9-11-6-8-20-10-11)5-7-17-12-3-1-2-4-13(12)21-15(17)19/h1-4,11H,5-10H2,(H,16,18) |
| InChIKey | HCSJRKPRKUWQIC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |