C14H15N5S — CID 53499873
N-(4,5,6,7-tetrahydro-1-benzothiophen-2-ylmethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 53499873) has the molecular formula C14H15N5S and a molecular weight of 285.38 g/mol. Its IUPAC name is N-(4,5,6,7-tetrahydro-1-benzothiophen-2-ylmethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-(4,5,6,7-tetrahydro-1-benzothiophen-2-ylmethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 53499873 |
| Molecular Formula | C14H15N5S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-(4,5,6,7-tetrahydro-1-benzothiophen-2-ylmethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | c1cc2nncn2nc1NCc1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C14H15N5S/c1-2-4-12-10(3-1)7-11(20-12)8-15-13-5-6-14-17-16-9-19(14)18-13/h5-7,9H,1-4,8H2,(H,15,18) |
| InChIKey | CEVFBXCCEBGIIG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |