About methyl 8-oxooctanoate
methyl 8-oxooctanoate (PubChem CID 535040) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is methyl 8-oxooctanoate.
Molecular Properties
| Compound Name | methyl 8-oxooctanoate |
| PubChem CID | 535040 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | methyl 8-oxooctanoate |
| SMILES | COC(=O)CCCCCCC=O |
| InChI | InChI=1S/C9H16O3/c1-12-9(11)7-5-3-2-4-6-8-10/h8H,2-7H2,1H3 |
| InChIKey | HVAXGLYKECRETN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-oxooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-oxooctanoate?
The IUPAC name of methyl 8-oxooctanoate (CID 535040) is methyl 8-oxooctanoate.
What is the SMILES notation for methyl 8-oxooctanoate?
The canonical SMILES for methyl 8-oxooctanoate is COC(=O)CCCCCCC=O.
What is the InChIKey of methyl 8-oxooctanoate?
The InChIKey is HVAXGLYKECRETN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-12-9(11)7-5-3-2-4-6-8-10/h8H,2-7H2,1H3.
What are the key properties of methyl 8-oxooctanoate?
methyl 8-oxooctanoate has a molecular weight of 172.22 g/mol, XLogP of 1.70, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-oxooctanoate is sourced from PubChem (CID 535040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).