C14H25ClO — CID 535082
4-chloro-1,3,3a,4,5,6,7,8,9,10,11,12,13,13a-tetradecahydrocyclododeca[c]furan (PubChem CID 535082) has the molecular formula C14H25ClO and a molecular weight of 244.81 g/mol. Its IUPAC name is 4-chloro-1,3,3a,4,5,6,7,8,9,10,11,12,13,13a-tetradecahydrocyclododeca[c]furan.
| Compound Name | 4-chloro-1,3,3a,4,5,6,7,8,9,10,11,12,13,13a-tetradecahydrocyclododeca[c]furan |
|---|---|
| PubChem CID | 535082 |
| Molecular Formula | C14H25ClO |
| Molecular Weight | 244.81 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 4-chloro-1,3,3a,4,5,6,7,8,9,10,11,12,13,13a-tetradecahydrocyclododeca[c]furan |
| SMILES | ClC1CCCCCCCCCC2COCC12 |
| InChI | InChI=1S/C14H25ClO/c15-14-9-7-5-3-1-2-4-6-8-12-10-16-11-13(12)14/h12-14H,1-11H2 |
| InChIKey | YSHATVXPPJXURB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.81 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|