About 3-(2-chlorophenyl)-7-hydroxy-2,8-dimethylchromen-4-one
3-(2-chlorophenyl)-7-hydroxy-2,8-dimethylchromen-4-one (PubChem CID 5350853) has the molecular formula C17H13ClO3
and a molecular weight of 300.74 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-7-hydroxy-2,8-dimethylchromen-4-one.
Molecular Properties
| Compound Name | 3-(2-chlorophenyl)-7-hydroxy-2,8-dimethylchromen-4-one |
| PubChem CID | 5350853 |
| Molecular Formula | C17H13ClO3 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 3-(2-chlorophenyl)-7-hydroxy-2,8-dimethylchromen-4-one |
| SMILES | Cc1oc2c(C)c(O)ccc2c(=O)c1-c1ccccc1Cl |
| InChI | InChI=1S/C17H13ClO3/c1-9-14(19)8-7-12-16(20)15(10(2)21-17(9)12)11-5-3-4-6-13(11)18/h3-8,19H,1-2H3 |
| InChIKey | HNLFTKVLUMIPMQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-chlorophenyl)-7-hydroxy-2,8-dimethylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chlorophenyl)-7-hydroxy-2,8-dimethylchromen-4-one?
The IUPAC name of 3-(2-chlorophenyl)-7-hydroxy-2,8-dimethylchromen-4-one (CID 5350853) is 3-(2-chlorophenyl)-7-hydroxy-2,8-dimethylchromen-4-one.
What is the SMILES notation for 3-(2-chlorophenyl)-7-hydroxy-2,8-dimethylchromen-4-one?
The canonical SMILES for 3-(2-chlorophenyl)-7-hydroxy-2,8-dimethylchromen-4-one is Cc1oc2c(C)c(O)ccc2c(=O)c1-c1ccccc1Cl.
What is the InChIKey of 3-(2-chlorophenyl)-7-hydroxy-2,8-dimethylchromen-4-one?
The InChIKey is HNLFTKVLUMIPMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClO3/c1-9-14(19)8-7-12-16(20)15(10(2)21-17(9)12)11-5-3-4-6-13(11)18/h3-8,19H,1-2H3.
What are the key properties of 3-(2-chlorophenyl)-7-hydroxy-2,8-dimethylchromen-4-one?
3-(2-chlorophenyl)-7-hydroxy-2,8-dimethylchromen-4-one has a molecular weight of 300.74 g/mol, XLogP of 4.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chlorophenyl)-7-hydroxy-2,8-dimethylchromen-4-one is sourced from PubChem (CID 5350853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).