C21H20FN3O4 — CID 5350862
(5Z)-5-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 5350862) has the molecular formula C21H20FN3O4 and a molecular weight of 397.41 g/mol. Its IUPAC name is (5Z)-5-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 5350862 |
| Molecular Formula | C21H20FN3O4 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | (5Z)-5-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCN(CC)c1ccc(/C=C2/C(=O)NC(=O)N(c3ccccc3F)C2=O)c(O)c1 |
| InChI | InChI=1S/C21H20FN3O4/c1-3-24(4-2)14-10-9-13(18(26)12-14)11-15-19(27)23-21(29)25(20(15)28)17-8-6-5-7-16(17)22/h5-12,26H,3-4H2,1-2H3,(H,23,27,29)/b15-11- |
| InChIKey | UEZJPCACURQJFR-PTNGSMBKSA-N |
| XLogP | 3.04 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|