About 5,9-Dimethyl-9-decen-3-ol
5,9-Dimethyl-9-decen-3-ol (PubChem CID 535090) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is 5,9-dimethyldec-9-en-3-ol.
Molecular Properties
| Compound Name | 5,9-Dimethyl-9-decen-3-ol |
| PubChem CID | 535090 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 5,9-dimethyldec-9-en-3-ol |
| SMILES | CCC(CC(C)CCCC(=C)C)O |
| InChI | InChI=1S/C12H24O/c1-5-12(13)9-11(4)8-6-7-10(2)3/h11-13H,2,5-9H2,1,3-4H3 |
| InChIKey | CNGGPKWJEPGPQH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | 140 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,9-Dimethyl-9-decen-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,9-Dimethyl-9-decen-3-ol?
The IUPAC name of 5,9-Dimethyl-9-decen-3-ol (CID 535090) is 5,9-dimethyldec-9-en-3-ol.
What is the SMILES notation for 5,9-Dimethyl-9-decen-3-ol?
The canonical SMILES for 5,9-Dimethyl-9-decen-3-ol is CCC(CC(C)CCCC(=C)C)O.
What is the InChIKey of 5,9-Dimethyl-9-decen-3-ol?
The InChIKey is CNGGPKWJEPGPQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O/c1-5-12(13)9-11(4)8-6-7-10(2)3/h11-13H,2,5-9H2,1,3-4H3.
What are the key properties of 5,9-Dimethyl-9-decen-3-ol?
5,9-Dimethyl-9-decen-3-ol has a molecular weight of 184.32 g/mol, XLogP of 4.50, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,9-Dimethyl-9-decen-3-ol is sourced from PubChem (CID 535090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).