C19H36 — CID 535091
5-butyl-6-hexyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 535091) has the molecular formula C19H36 and a molecular weight of 264.50 g/mol. Its IUPAC name is 5-butyl-6-hexyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 5-butyl-6-hexyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 535091 |
| Molecular Formula | C19H36 |
| Molecular Weight | 264.50 g/mol |
| Exact Mass | 264.28 |
| IUPAC Name | 5-butyl-6-hexyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CCCCCCC1CC2CCCC2CC1CCCC |
| InChI | InChI=1S/C19H36/c1-3-5-7-8-11-17-15-19-13-9-12-18(19)14-16(17)10-6-4-2/h16-19H,3-15H2,1-2H3 |
| InChIKey | AZGPNRBWIVZVPD-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.50 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|