C16H22O3 — CID 535096
4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8,9,9a-hexahydro-3aH-benzo[f][1,3]benzodioxol-2-one (PubChem CID 535096) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8,9,9a-hexahydro-3aH-benzo[f][1,3]benzodioxol-2-one.
| Compound Name | 4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8,9,9a-hexahydro-3aH-benzo[f][1,3]benzodioxol-2-one |
|---|---|
| PubChem CID | 535096 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8,9,9a-hexahydro-3aH-benzo[f][1,3]benzodioxol-2-one |
| SMILES | C=C(C)C1CCC2(C)CC3OC(=O)OC3C(C)=C2C1 |
| InChI | InChI=1S/C16H22O3/c1-9(2)11-5-6-16(4)8-13-14(19-15(17)18-13)10(3)12(16)7-11/h11,13-14H,1,5-8H2,2-4H3 |
| InChIKey | UQFORZAEYWOXKY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|