C8H12N6 — CID 535108
3-N,6-N-bis(prop-2-enyl)-1,2,4,5-tetrazine-3,6-diamine (PubChem CID 535108) has the molecular formula C8H12N6 and a molecular weight of 192.23 g/mol. Its IUPAC name is 3-N,6-N-bis(prop-2-enyl)-1,2,4,5-tetrazine-3,6-diamine.
| Compound Name | 3-N,6-N-bis(prop-2-enyl)-1,2,4,5-tetrazine-3,6-diamine |
|---|---|
| PubChem CID | 535108 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 3-N,6-N-bis(prop-2-enyl)-1,2,4,5-tetrazine-3,6-diamine |
| SMILES | C=CCNc1nnc(NCC=C)nn1 |
| InChI | InChI=1S/C8H12N6/c1-3-5-9-7-11-13-8(14-12-7)10-6-4-2/h3-4H,1-2,5-6H2,(H,9,11,12)(H,10,13,14) |
| InChIKey | YCGNKCFJRWTAGK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|