About 4-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]quinoline
4-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]quinoline (PubChem CID 5351198) has the molecular formula C20H19NO3
and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]quinoline.
Molecular Properties
| Compound Name | 4-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]quinoline |
| PubChem CID | 5351198 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 4-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]quinoline |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/c1ccnc2ccccc12 |
| InChI | InChI=1S/C20H19NO3/c1-22-18-13-20(24-3)19(23-2)12-15(18)9-8-14-10-11-21-17-7-5-4-6-16(14)17/h4-13H,1-3H3/b9-8+ |
| InChIKey | XPYLMRIXEKTASO-CMDGGOBGSA-N |
| XLogP | 4.43 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]quinoline?
The IUPAC name of 4-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]quinoline (CID 5351198) is 4-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]quinoline.
What is the SMILES notation for 4-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]quinoline?
The canonical SMILES for 4-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]quinoline is COc1cc(OC)c(OC)cc1/C=C/c1ccnc2ccccc12.
What is the InChIKey of 4-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]quinoline?
The InChIKey is XPYLMRIXEKTASO-CMDGGOBGSA-N. The full InChI is InChI=1S/C20H19NO3/c1-22-18-13-20(24-3)19(23-2)12-15(18)9-8-14-10-11-21-17-7-5-4-6-16(14)17/h4-13H,1-3H3/b9-8+.
What are the key properties of 4-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]quinoline?
4-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]quinoline has a molecular weight of 321.38 g/mol, XLogP of 4.43, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]quinoline is sourced from PubChem (CID 5351198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).