About ethyl 2-prop-2-enoxypropanoate
ethyl 2-prop-2-enoxypropanoate (PubChem CID 535120) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is ethyl 2-prop-2-enoxypropanoate.
Molecular Properties
| Compound Name | ethyl 2-prop-2-enoxypropanoate |
| PubChem CID | 535120 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | ethyl 2-prop-2-enoxypropanoate |
| SMILES | C=CCOC(C)C(=O)OCC |
| InChI | InChI=1S/C8H14O3/c1-4-6-11-7(3)8(9)10-5-2/h4,7H,1,5-6H2,2-3H3 |
| InChIKey | SQKHGJLWNLPYMB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-prop-2-enoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-prop-2-enoxypropanoate?
The IUPAC name of ethyl 2-prop-2-enoxypropanoate (CID 535120) is ethyl 2-prop-2-enoxypropanoate.
What is the SMILES notation for ethyl 2-prop-2-enoxypropanoate?
The canonical SMILES for ethyl 2-prop-2-enoxypropanoate is C=CCOC(C)C(=O)OCC.
What is the InChIKey of ethyl 2-prop-2-enoxypropanoate?
The InChIKey is SQKHGJLWNLPYMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-4-6-11-7(3)8(9)10-5-2/h4,7H,1,5-6H2,2-3H3.
What are the key properties of ethyl 2-prop-2-enoxypropanoate?
ethyl 2-prop-2-enoxypropanoate has a molecular weight of 158.20 g/mol, XLogP of 1.14, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-prop-2-enoxypropanoate is sourced from PubChem (CID 535120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).