C13H10Cl2O3 — CID 5351233
2-(3,3-dichloroprop-2-enyl)-3-hydroxy-2,3-dihydronaphthalene-1,4-dione (PubChem CID 5351233) has the molecular formula C13H10Cl2O3 and a molecular weight of 285.13 g/mol. Its IUPAC name is 2-(3,3-dichloroprop-2-enyl)-3-hydroxy-2,3-dihydronaphthalene-1,4-dione.
| Compound Name | 2-(3,3-dichloroprop-2-enyl)-3-hydroxy-2,3-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 5351233 |
| Molecular Formula | C13H10Cl2O3 |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 2-(3,3-dichloroprop-2-enyl)-3-hydroxy-2,3-dihydronaphthalene-1,4-dione |
| SMILES | O=C1c2ccccc2C(=O)C(CC=C(Cl)Cl)C1O |
| InChI | InChI=1S/C13H10Cl2O3/c14-10(15)6-5-9-11(16)7-3-1-2-4-8(7)12(17)13(9)18/h1-4,6,9,13,18H,5H2 |
| InChIKey | TVKAVTYTHYWIAG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|