About 2,2-dimethyl-1,3-dithiane 1-oxide
2,2-dimethyl-1,3-dithiane 1-oxide (PubChem CID 535129) has the molecular formula C6H12OS2
and a molecular weight of 164.29 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dithiane 1-oxide.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,3-dithiane 1-oxide |
| PubChem CID | 535129 |
| Molecular Formula | C6H12OS2 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 2,2-dimethyl-1,3-dithiane 1-oxide |
| SMILES | CC1(C)SCCCS1=O |
| InChI | InChI=1S/C6H12OS2/c1-6(2)8-4-3-5-9(6)7/h3-5H2,1-2H3 |
| InChIKey | YJZNKYDKTBJXRB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyl-1,3-dithiane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,3-dithiane 1-oxide?
The IUPAC name of 2,2-dimethyl-1,3-dithiane 1-oxide (CID 535129) is 2,2-dimethyl-1,3-dithiane 1-oxide.
What is the SMILES notation for 2,2-dimethyl-1,3-dithiane 1-oxide?
The canonical SMILES for 2,2-dimethyl-1,3-dithiane 1-oxide is CC1(C)SCCCS1=O.
What is the InChIKey of 2,2-dimethyl-1,3-dithiane 1-oxide?
The InChIKey is YJZNKYDKTBJXRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12OS2/c1-6(2)8-4-3-5-9(6)7/h3-5H2,1-2H3.
What are the key properties of 2,2-dimethyl-1,3-dithiane 1-oxide?
2,2-dimethyl-1,3-dithiane 1-oxide has a molecular weight of 164.29 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,3-dithiane 1-oxide is sourced from PubChem (CID 535129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).