About (E)-5-(diethylamino)-4,4-dimethyl-1-(4-methylphenyl)pent-1-en-3-one;hydrobromide
(E)-5-(diethylamino)-4,4-dimethyl-1-(4-methylphenyl)pent-1-en-3-one;hydrobromide (PubChem CID 5351334) has the molecular formula C18H28BrNO
and a molecular weight of 354.33 g/mol. Its IUPAC name is (E)-5-(diethylamino)-4,4-dimethyl-1-(4-methylphenyl)pent-1-en-3-one;hydrobromide.
Molecular Properties
| Compound Name | (E)-5-(diethylamino)-4,4-dimethyl-1-(4-methylphenyl)pent-1-en-3-one;hydrobromide |
| PubChem CID | 5351334 |
| Molecular Formula | C18H28BrNO |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (E)-5-(diethylamino)-4,4-dimethyl-1-(4-methylphenyl)pent-1-en-3-one;hydrobromide |
| SMILES | Br.CCN(CC)CC(C)(C)C(=O)/C=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C18H27NO.BrH/c1-6-19(7-2)14-18(4,5)17(20)13-12-16-10-8-15(3)9-11-16;/h8-13H,6-7,14H2,1-5H3;1H/b13-12+; |
| InChIKey | LFYDERZZJPZNGL-UEIGIMKUSA-N |
| XLogP | 4.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-(diethylamino)-4,4-dimethyl-1-(4-methylphenyl)pent-1-en-3-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-(diethylamino)-4,4-dimethyl-1-(4-methylphenyl)pent-1-en-3-one;hydrobromide?
The IUPAC name of (E)-5-(diethylamino)-4,4-dimethyl-1-(4-methylphenyl)pent-1-en-3-one;hydrobromide (CID 5351334) is (E)-5-(diethylamino)-4,4-dimethyl-1-(4-methylphenyl)pent-1-en-3-one;hydrobromide.
What is the SMILES notation for (E)-5-(diethylamino)-4,4-dimethyl-1-(4-methylphenyl)pent-1-en-3-one;hydrobromide?
The canonical SMILES for (E)-5-(diethylamino)-4,4-dimethyl-1-(4-methylphenyl)pent-1-en-3-one;hydrobromide is Br.CCN(CC)CC(C)(C)C(=O)/C=C/c1ccc(C)cc1.
What is the InChIKey of (E)-5-(diethylamino)-4,4-dimethyl-1-(4-methylphenyl)pent-1-en-3-one;hydrobromide?
The InChIKey is LFYDERZZJPZNGL-UEIGIMKUSA-N. The full InChI is InChI=1S/C18H27NO.BrH/c1-6-19(7-2)14-18(4,5)17(20)13-12-16-10-8-15(3)9-11-16;/h8-13H,6-7,14H2,1-5H3;1H/b13-12+;.
What are the key properties of (E)-5-(diethylamino)-4,4-dimethyl-1-(4-methylphenyl)pent-1-en-3-one;hydrobromide?
(E)-5-(diethylamino)-4,4-dimethyl-1-(4-methylphenyl)pent-1-en-3-one;hydrobromide has a molecular weight of 354.33 g/mol, XLogP of 4.52, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-(diethylamino)-4,4-dimethyl-1-(4-methylphenyl)pent-1-en-3-one;hydrobromide is sourced from PubChem (CID 5351334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).