C15H11ClNO2S2+ — CID 5351417
(2E)-6-acetyl-2-[(2-chlorophenyl)methylidene]-5-methyl-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-3-one (PubChem CID 5351417) has the molecular formula C15H11ClNO2S2+ and a molecular weight of 336.85 g/mol. Its IUPAC name is (2E)-6-acetyl-2-[(2-chlorophenyl)methylidene]-5-methyl-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-3-one.
| Compound Name | (2E)-6-acetyl-2-[(2-chlorophenyl)methylidene]-5-methyl-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-3-one |
|---|---|
| PubChem CID | 5351417 |
| Molecular Formula | C15H11ClNO2S2+ |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | (2E)-6-acetyl-2-[(2-chlorophenyl)methylidene]-5-methyl-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-3-one |
| SMILES | CC(=O)c1sc2[n+](c1C)C(=O)/C(=C\c1ccccc1Cl)S2 |
| InChI | InChI=1S/C15H11ClNO2S2/c1-8-13(9(2)18)21-15-17(8)14(19)12(20-15)7-10-5-3-4-6-11(10)16/h3-7H,1-2H3/q+1/b12-7+ |
| InChIKey | VOSPTOAMNUGYRV-KPKJPENVSA-N |
| XLogP | 3.99 |
| TPSA | 38.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|