About [(E)-8-tetracyclo[4.3.0.02,4.03,7]nonanylideneamino]urea
[(E)-8-tetracyclo[4.3.0.02,4.03,7]nonanylideneamino]urea (PubChem CID 5351429) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is [(E)-8-tetracyclo[4.3.0.02,4.03,7]nonanylideneamino]urea.
Molecular Properties
| Compound Name | [(E)-8-tetracyclo[4.3.0.02,4.03,7]nonanylideneamino]urea |
| PubChem CID | 5351429 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | [(E)-8-tetracyclo[4.3.0.02,4.03,7]nonanylideneamino]urea |
| SMILES | NC(=O)N/N=C1\CC2C3CC4C2C4C13 |
| InChI | InChI=1S/C10H13N3O/c11-10(14)13-12-6-2-4-3-1-5-7(4)9(5)8(3)6/h3-5,7-9H,1-2H2,(H3,11,13,14)/b12-6+ |
| InChIKey | GBWINHSBPKVUGH-WUXMJOGZSA-N |
| XLogP | 0.54 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-8-tetracyclo[4.3.0.02,4.03,7]nonanylideneamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-8-tetracyclo[4.3.0.02,4.03,7]nonanylideneamino]urea?
The IUPAC name of [(E)-8-tetracyclo[4.3.0.02,4.03,7]nonanylideneamino]urea (CID 5351429) is [(E)-8-tetracyclo[4.3.0.02,4.03,7]nonanylideneamino]urea.
What is the SMILES notation for [(E)-8-tetracyclo[4.3.0.02,4.03,7]nonanylideneamino]urea?
The canonical SMILES for [(E)-8-tetracyclo[4.3.0.02,4.03,7]nonanylideneamino]urea is NC(=O)N/N=C1\CC2C3CC4C2C4C13.
What is the InChIKey of [(E)-8-tetracyclo[4.3.0.02,4.03,7]nonanylideneamino]urea?
The InChIKey is GBWINHSBPKVUGH-WUXMJOGZSA-N. The full InChI is InChI=1S/C10H13N3O/c11-10(14)13-12-6-2-4-3-1-5-7(4)9(5)8(3)6/h3-5,7-9H,1-2H2,(H3,11,13,14)/b12-6+.
What are the key properties of [(E)-8-tetracyclo[4.3.0.02,4.03,7]nonanylideneamino]urea?
[(E)-8-tetracyclo[4.3.0.02,4.03,7]nonanylideneamino]urea has a molecular weight of 191.23 g/mol, XLogP of 0.54, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-8-tetracyclo[4.3.0.02,4.03,7]nonanylideneamino]urea is sourced from PubChem (CID 5351429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).