C18H25BN2O3 — CID 5351432
[(1R)-1-[[(2S)-2-amino-3-naphthalen-1-ylpropanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 5351432) has the molecular formula C18H25BN2O3 and a molecular weight of 328.22 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-amino-3-naphthalen-1-ylpropanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2-amino-3-naphthalen-1-ylpropanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 5351432 |
| Molecular Formula | C18H25BN2O3 |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | [(1R)-1-[[(2S)-2-amino-3-naphthalen-1-ylpropanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)Cc1cccc2ccccc12)B(O)O |
| InChI | InChI=1S/C18H25BN2O3/c1-12(2)10-17(19(23)24)21-18(22)16(20)11-14-8-5-7-13-6-3-4-9-15(13)14/h3-9,12,16-17,23-24H,10-11,20H2,1-2H3,(H,21,22)/t16-,17-/m0/s1 |
| InChIKey | YTOBIBVCJFPUEV-IRXDYDNUSA-N |
| XLogP | 1.25 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|