About (2-benzylphenyl)-(2,5-dimethylphenyl)methanimine;hydrochloride
(2-benzylphenyl)-(2,5-dimethylphenyl)methanimine;hydrochloride (PubChem CID 5351937) has the molecular formula C22H22ClN
and a molecular weight of 335.88 g/mol. Its IUPAC name is (2-benzylphenyl)-(2,5-dimethylphenyl)methanimine;hydrochloride.
Molecular Properties
| Compound Name | (2-benzylphenyl)-(2,5-dimethylphenyl)methanimine;hydrochloride |
| PubChem CID | 5351937 |
| Molecular Formula | C22H22ClN |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (2-benzylphenyl)-(2,5-dimethylphenyl)methanimine;hydrochloride |
| SMILES | Cl.[H]/N=C(/c1cc(C)ccc1C)c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C22H21N.ClH/c1-16-12-13-17(2)21(14-16)22(23)20-11-7-6-10-19(20)15-18-8-4-3-5-9-18;/h3-14,23H,15H2,1-2H3;1H/b23-22+; |
| InChIKey | RMNPDFCSFVPFKZ-PGCQSHBKSA-N |
| XLogP | 5.73 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2-benzylphenyl)-(2,5-dimethylphenyl)methanimine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzylphenyl)-(2,5-dimethylphenyl)methanimine;hydrochloride?
The IUPAC name of (2-benzylphenyl)-(2,5-dimethylphenyl)methanimine;hydrochloride (CID 5351937) is (2-benzylphenyl)-(2,5-dimethylphenyl)methanimine;hydrochloride.
What is the SMILES notation for (2-benzylphenyl)-(2,5-dimethylphenyl)methanimine;hydrochloride?
The canonical SMILES for (2-benzylphenyl)-(2,5-dimethylphenyl)methanimine;hydrochloride is Cl.[H]/N=C(/c1cc(C)ccc1C)c1ccccc1Cc1ccccc1.
What is the InChIKey of (2-benzylphenyl)-(2,5-dimethylphenyl)methanimine;hydrochloride?
The InChIKey is RMNPDFCSFVPFKZ-PGCQSHBKSA-N. The full InChI is InChI=1S/C22H21N.ClH/c1-16-12-13-17(2)21(14-16)22(23)20-11-7-6-10-19(20)15-18-8-4-3-5-9-18;/h3-14,23H,15H2,1-2H3;1H/b23-22+;.
What are the key properties of (2-benzylphenyl)-(2,5-dimethylphenyl)methanimine;hydrochloride?
(2-benzylphenyl)-(2,5-dimethylphenyl)methanimine;hydrochloride has a molecular weight of 335.88 g/mol, XLogP of 5.73, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzylphenyl)-(2,5-dimethylphenyl)methanimine;hydrochloride is sourced from PubChem (CID 5351937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).