About (3,5-dimethylphenyl)-[2-(naphthalen-1-ylmethyl)phenyl]methanimine;hydrochloride
(3,5-dimethylphenyl)-[2-(naphthalen-1-ylmethyl)phenyl]methanimine;hydrochloride (PubChem CID 5351940) has the molecular formula C26H24ClN
and a molecular weight of 385.94 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-[2-(naphthalen-1-ylmethyl)phenyl]methanimine;hydrochloride.
Molecular Properties
| Compound Name | (3,5-dimethylphenyl)-[2-(naphthalen-1-ylmethyl)phenyl]methanimine;hydrochloride |
| PubChem CID | 5351940 |
| Molecular Formula | C26H24ClN |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (3,5-dimethylphenyl)-[2-(naphthalen-1-ylmethyl)phenyl]methanimine;hydrochloride |
| SMILES | Cl.[H]/N=C(\c1cc(C)cc(C)c1)c1ccccc1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C26H23N.ClH/c1-18-14-19(2)16-23(15-18)26(27)25-13-6-4-9-22(25)17-21-11-7-10-20-8-3-5-12-24(20)21;/h3-16,27H,17H2,1-2H3;1H/b27-26+; |
| InChIKey | WOMKVSGMAMIPRV-JGUILPGDSA-N |
| XLogP | 6.89 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dimethylphenyl)-[2-(naphthalen-1-ylmethyl)phenyl]methanimine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethylphenyl)-[2-(naphthalen-1-ylmethyl)phenyl]methanimine;hydrochloride?
The IUPAC name of (3,5-dimethylphenyl)-[2-(naphthalen-1-ylmethyl)phenyl]methanimine;hydrochloride (CID 5351940) is (3,5-dimethylphenyl)-[2-(naphthalen-1-ylmethyl)phenyl]methanimine;hydrochloride.
What is the SMILES notation for (3,5-dimethylphenyl)-[2-(naphthalen-1-ylmethyl)phenyl]methanimine;hydrochloride?
The canonical SMILES for (3,5-dimethylphenyl)-[2-(naphthalen-1-ylmethyl)phenyl]methanimine;hydrochloride is Cl.[H]/N=C(\c1cc(C)cc(C)c1)c1ccccc1Cc1cccc2ccccc12.
What is the InChIKey of (3,5-dimethylphenyl)-[2-(naphthalen-1-ylmethyl)phenyl]methanimine;hydrochloride?
The InChIKey is WOMKVSGMAMIPRV-JGUILPGDSA-N. The full InChI is InChI=1S/C26H23N.ClH/c1-18-14-19(2)16-23(15-18)26(27)25-13-6-4-9-22(25)17-21-11-7-10-20-8-3-5-12-24(20)21;/h3-16,27H,17H2,1-2H3;1H/b27-26+;.
What are the key properties of (3,5-dimethylphenyl)-[2-(naphthalen-1-ylmethyl)phenyl]methanimine;hydrochloride?
(3,5-dimethylphenyl)-[2-(naphthalen-1-ylmethyl)phenyl]methanimine;hydrochloride has a molecular weight of 385.94 g/mol, XLogP of 6.89, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethylphenyl)-[2-(naphthalen-1-ylmethyl)phenyl]methanimine;hydrochloride is sourced from PubChem (CID 5351940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).