About (4Z)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dien-1-ol
(4Z)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dien-1-ol (PubChem CID 5352147) has the molecular formula C15H26O
and a molecular weight of 222.37 g/mol. Its IUPAC name is (4Z)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dien-1-ol.
Molecular Properties
| Compound Name | (4Z)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dien-1-ol |
| PubChem CID | 5352147 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (4Z)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dien-1-ol |
| SMILES | C=C(C)C(CO)C/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C15H26O/c1-12(2)7-6-8-14(5)9-10-15(11-16)13(3)4/h7,9,15-16H,3,6,8,10-11H2,1-2,4-5H3/b14-9- |
| InChIKey | JTSPVWIYQLSMER-ZROIWOOFSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dien-1-ol?
The IUPAC name of (4Z)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dien-1-ol (CID 5352147) is (4Z)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dien-1-ol.
What is the SMILES notation for (4Z)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dien-1-ol?
The canonical SMILES for (4Z)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dien-1-ol is C=C(C)C(CO)C/C=C(/C)CCC=C(C)C.
What is the InChIKey of (4Z)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dien-1-ol?
The InChIKey is JTSPVWIYQLSMER-ZROIWOOFSA-N. The full InChI is InChI=1S/C15H26O/c1-12(2)7-6-8-14(5)9-10-15(11-16)13(3)4/h7,9,15-16H,3,6,8,10-11H2,1-2,4-5H3/b14-9-.
What are the key properties of (4Z)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dien-1-ol?
(4Z)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dien-1-ol has a molecular weight of 222.37 g/mol, XLogP of 4.25, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dien-1-ol is sourced from PubChem (CID 5352147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).