C15H26 — CID 535217
1,1,2-trimethyl-3,5-bis(prop-1-en-2-yl)cyclohexane (PubChem CID 535217) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is 1,1,2-trimethyl-3,5-bis(prop-1-en-2-yl)cyclohexane.
| Compound Name | 1,1,2-trimethyl-3,5-bis(prop-1-en-2-yl)cyclohexane |
|---|---|
| PubChem CID | 535217 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 1,1,2-trimethyl-3,5-bis(prop-1-en-2-yl)cyclohexane |
| SMILES | C=C(C)C1CC(C(=C)C)C(C)C(C)(C)C1 |
| InChI | InChI=1S/C15H26/c1-10(2)13-8-14(11(3)4)12(5)15(6,7)9-13/h12-14H,1,3,8-9H2,2,4-7H3 |
| InChIKey | JGZYEZBCFOHEEC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|