C12H22O2 — CID 5352436
(2Z)-1,1-dimethoxy-3,7-dimethylocta-2,6-diene (PubChem CID 5352436) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (2Z)-1,1-dimethoxy-3,7-dimethylocta-2,6-diene.
| Compound Name | (2Z)-1,1-dimethoxy-3,7-dimethylocta-2,6-diene |
|---|---|
| PubChem CID | 5352436 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (2Z)-1,1-dimethoxy-3,7-dimethylocta-2,6-diene |
| SMILES | COC(/C=C(/C)CCC=C(C)C)OC |
| InChI | InChI=1S/C12H22O2/c1-10(2)7-6-8-11(3)9-12(13-4)14-5/h7,9,12H,6,8H2,1-5H3/b11-9- |
| InChIKey | ZSKAJFSSXURRGL-LUAWRHEFSA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|