C17H28O — CID 5352449
(6E,11E)-3,7,13-trimethyltetradeca-1,6,11,13-tetraen-3-ol (PubChem CID 5352449) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (6E,11E)-3,7,13-trimethyltetradeca-1,6,11,13-tetraen-3-ol.
| Compound Name | (6E,11E)-3,7,13-trimethyltetradeca-1,6,11,13-tetraen-3-ol |
|---|---|
| PubChem CID | 5352449 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (6E,11E)-3,7,13-trimethyltetradeca-1,6,11,13-tetraen-3-ol |
| SMILES | C=CC(C)(O)CC/C=C(\C)CCC/C=C/C(=C)C |
| InChI | InChI=1S/C17H28O/c1-6-17(5,18)14-10-13-16(4)12-9-7-8-11-15(2)3/h6,8,11,13,18H,1-2,7,9-10,12,14H2,3-5H3/b11-8+,16-13+ |
| InChIKey | XCTSDLUOCRRDLZ-YZLWMTBJSA-N |
| XLogP | 4.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|