C29H48 — CID 5352455
(6E,10E,14E,18E)-2,6,10,19,23-pentamethyltetracosa-2,6,10,14,18,22-hexaene (PubChem CID 5352455) has the molecular formula C29H48 and a molecular weight of 396.70 g/mol. Its IUPAC name is (6E,10E,14E,18E)-2,6,10,19,23-pentamethyltetracosa-2,6,10,14,18,22-hexaene.
| Compound Name | (6E,10E,14E,18E)-2,6,10,19,23-pentamethyltetracosa-2,6,10,14,18,22-hexaene |
|---|---|
| PubChem CID | 5352455 |
| Molecular Formula | C29H48 |
| Molecular Weight | 396.70 g/mol |
| Exact Mass | 396.38 |
| IUPAC Name | (6E,10E,14E,18E)-2,6,10,19,23-pentamethyltetracosa-2,6,10,14,18,22-hexaene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C29H48/c1-25(2)17-14-21-27(5)19-12-10-8-9-11-13-20-28(6)23-16-24-29(7)22-15-18-26(3)4/h8-9,17-20,24H,10-16,21-23H2,1-7H3/b9-8+,27-19+,28-20+,29-24+ |
| InChIKey | BBCQGYMUMKNTQE-BAIGTOHMSA-N |
| XLogP | 10.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.70 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|