C15H24O — CID 5352485
[(2E,5E,9E)-1,5,9-trimethylcycloundeca-2,5,9-trien-1-yl]methanol (PubChem CID 5352485) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is [(2E,5E,9E)-1,5,9-trimethylcycloundeca-2,5,9-trien-1-yl]methanol.
| Compound Name | [(2E,5E,9E)-1,5,9-trimethylcycloundeca-2,5,9-trien-1-yl]methanol |
|---|---|
| PubChem CID | 5352485 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | [(2E,5E,9E)-1,5,9-trimethylcycloundeca-2,5,9-trien-1-yl]methanol |
| SMILES | C/C1=C\CC/C(C)=C/CC(C)(CO)/C=C/C1 |
| InChI | InChI=1S/C15H24O/c1-13-6-4-7-14(2)9-11-15(3,12-16)10-5-8-13/h5-6,9-10,16H,4,7-8,11-12H2,1-3H3/b10-5+,13-6+,14-9+ |
| InChIKey | YLOBZQJVNNUEPZ-NYAJVKMDSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|