About (2Z)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]non-3-ene
(2Z)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]non-3-ene (PubChem CID 5352494) has the molecular formula C13H12O2
and a molecular weight of 200.24 g/mol. Its IUPAC name is (2Z)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]non-3-ene.
Molecular Properties
| Compound Name | (2Z)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]non-3-ene |
| PubChem CID | 5352494 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (2Z)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]non-3-ene |
| SMILES | CC#CC#C/C=C1/C=CC2(CCCO2)O1 |
| InChI | InChI=1S/C13H12O2/c1-2-3-4-5-7-12-8-10-13(15-12)9-6-11-14-13/h7-8,10H,6,9,11H2,1H3/b12-7- |
| InChIKey | WTRXKCNFPMTAJV-GHXNOFRVSA-N |
| XLogP | 1.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]non-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]non-3-ene?
The IUPAC name of (2Z)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]non-3-ene (CID 5352494) is (2Z)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]non-3-ene.
What is the SMILES notation for (2Z)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]non-3-ene?
The canonical SMILES for (2Z)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]non-3-ene is CC#CC#C/C=C1/C=CC2(CCCO2)O1.
What is the InChIKey of (2Z)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]non-3-ene?
The InChIKey is WTRXKCNFPMTAJV-GHXNOFRVSA-N. The full InChI is InChI=1S/C13H12O2/c1-2-3-4-5-7-12-8-10-13(15-12)9-6-11-14-13/h7-8,10H,6,9,11H2,1H3/b12-7-.
What are the key properties of (2Z)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]non-3-ene?
(2Z)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]non-3-ene has a molecular weight of 200.24 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]non-3-ene is sourced from PubChem (CID 5352494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).