About [(E)-hex-3-enyl] benzoate
[(E)-hex-3-enyl] benzoate (PubChem CID 5352601) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is [(E)-hex-3-enyl] benzoate.
Molecular Properties
| Compound Name | [(E)-hex-3-enyl] benzoate |
| PubChem CID | 5352601 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | [(E)-hex-3-enyl] benzoate |
| SMILES | CC/C=C/CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16O2/c1-2-3-4-8-11-15-13(14)12-9-6-5-7-10-12/h3-7,9-10H,2,8,11H2,1H3/b4-3+ |
| InChIKey | BCOXBEHFBZOJJZ-ONEGZZNKSA-N |
| XLogP | 3.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-hex-3-enyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-hex-3-enyl] benzoate?
The IUPAC name of [(E)-hex-3-enyl] benzoate (CID 5352601) is [(E)-hex-3-enyl] benzoate.
What is the SMILES notation for [(E)-hex-3-enyl] benzoate?
The canonical SMILES for [(E)-hex-3-enyl] benzoate is CC/C=C/CCOC(=O)c1ccccc1.
What is the InChIKey of [(E)-hex-3-enyl] benzoate?
The InChIKey is BCOXBEHFBZOJJZ-ONEGZZNKSA-N. The full InChI is InChI=1S/C13H16O2/c1-2-3-4-8-11-15-13(14)12-9-6-5-7-10-12/h3-7,9-10H,2,8,11H2,1H3/b4-3+.
What are the key properties of [(E)-hex-3-enyl] benzoate?
[(E)-hex-3-enyl] benzoate has a molecular weight of 204.27 g/mol, XLogP of 3.20, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-hex-3-enyl] benzoate is sourced from PubChem (CID 5352601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).