About 4-(2,3-dimethylbut-2-enyl)-2,3-dihydropyran-6-one
4-(2,3-dimethylbut-2-enyl)-2,3-dihydropyran-6-one (PubChem CID 535261) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-(2,3-dimethylbut-2-enyl)-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 4-(2,3-dimethylbut-2-enyl)-2,3-dihydropyran-6-one |
| PubChem CID | 535261 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 4-(2,3-dimethylbut-2-enyl)-2,3-dihydropyran-6-one |
| SMILES | CC(C)=C(C)CC1=CC(=O)OCC1 |
| InChI | InChI=1S/C11H16O2/c1-8(2)9(3)6-10-4-5-13-11(12)7-10/h7H,4-6H2,1-3H3 |
| InChIKey | GLSBDSXQKDBXGQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-dimethylbut-2-enyl)-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dimethylbut-2-enyl)-2,3-dihydropyran-6-one?
The IUPAC name of 4-(2,3-dimethylbut-2-enyl)-2,3-dihydropyran-6-one (CID 535261) is 4-(2,3-dimethylbut-2-enyl)-2,3-dihydropyran-6-one.
What is the SMILES notation for 4-(2,3-dimethylbut-2-enyl)-2,3-dihydropyran-6-one?
The canonical SMILES for 4-(2,3-dimethylbut-2-enyl)-2,3-dihydropyran-6-one is CC(C)=C(C)CC1=CC(=O)OCC1.
What is the InChIKey of 4-(2,3-dimethylbut-2-enyl)-2,3-dihydropyran-6-one?
The InChIKey is GLSBDSXQKDBXGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-8(2)9(3)6-10-4-5-13-11(12)7-10/h7H,4-6H2,1-3H3.
What are the key properties of 4-(2,3-dimethylbut-2-enyl)-2,3-dihydropyran-6-one?
4-(2,3-dimethylbut-2-enyl)-2,3-dihydropyran-6-one has a molecular weight of 180.25 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dimethylbut-2-enyl)-2,3-dihydropyran-6-one is sourced from PubChem (CID 535261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).