C18H32N2 — CID 535273
2,2,5,5-tetramethyl-N-[(2,2,5,5-tetramethylcyclopentylidene)amino]cyclopentan-1-imine (PubChem CID 535273) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-[(2,2,5,5-tetramethylcyclopentylidene)amino]cyclopentan-1-imine.
| Compound Name | 2,2,5,5-tetramethyl-N-[(2,2,5,5-tetramethylcyclopentylidene)amino]cyclopentan-1-imine |
|---|---|
| PubChem CID | 535273 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-[(2,2,5,5-tetramethylcyclopentylidene)amino]cyclopentan-1-imine |
| SMILES | CC1(C)CCC(C)(C)C1=NN=C1C(C)(C)CCC1(C)C |
| InChI | InChI=1S/C18H32N2/c1-15(2)9-10-16(3,4)13(15)19-20-14-17(5,6)11-12-18(14,7)8/h9-12H2,1-8H3 |
| InChIKey | YQRRMUHZPXYBTG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|