About (3E)-5-ethoxyhexa-1,3-diene
(3E)-5-ethoxyhexa-1,3-diene (PubChem CID 5352776) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is (3E)-5-ethoxyhexa-1,3-diene.
Molecular Properties
| Compound Name | (3E)-5-ethoxyhexa-1,3-diene |
| PubChem CID | 5352776 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (3E)-5-ethoxyhexa-1,3-diene |
| SMILES | C=C/C=C/C(C)OCC |
| InChI | InChI=1S/C8H14O/c1-4-6-7-8(3)9-5-2/h4,6-8H,1,5H2,2-3H3/b7-6+ |
| InChIKey | IXTXFMUQEVEFFL-VOTSOKGWSA-N |
| XLogP | 2.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-5-ethoxyhexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5-ethoxyhexa-1,3-diene?
The IUPAC name of (3E)-5-ethoxyhexa-1,3-diene (CID 5352776) is (3E)-5-ethoxyhexa-1,3-diene.
What is the SMILES notation for (3E)-5-ethoxyhexa-1,3-diene?
The canonical SMILES for (3E)-5-ethoxyhexa-1,3-diene is C=C/C=C/C(C)OCC.
What is the InChIKey of (3E)-5-ethoxyhexa-1,3-diene?
The InChIKey is IXTXFMUQEVEFFL-VOTSOKGWSA-N. The full InChI is InChI=1S/C8H14O/c1-4-6-7-8(3)9-5-2/h4,6-8H,1,5H2,2-3H3/b7-6+.
What are the key properties of (3E)-5-ethoxyhexa-1,3-diene?
(3E)-5-ethoxyhexa-1,3-diene has a molecular weight of 126.20 g/mol, XLogP of 2.15, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5-ethoxyhexa-1,3-diene is sourced from PubChem (CID 5352776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).