C13H21F — CID 535279
1-fluoro-2-hex-1-ynyl-1,2,3,3-tetramethylcyclopropane (PubChem CID 535279) has the molecular formula C13H21F and a molecular weight of 196.31 g/mol. Its IUPAC name is 1-fluoro-2-hex-1-ynyl-1,2,3,3-tetramethylcyclopropane.
| Compound Name | 1-fluoro-2-hex-1-ynyl-1,2,3,3-tetramethylcyclopropane |
|---|---|
| PubChem CID | 535279 |
| Molecular Formula | C13H21F |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-fluoro-2-hex-1-ynyl-1,2,3,3-tetramethylcyclopropane |
| SMILES | CCCCC#CC1(C)C(C)(C)C1(C)F |
| InChI | InChI=1S/C13H21F/c1-6-7-8-9-10-12(4)11(2,3)13(12,5)14/h6-8H2,1-5H3 |
| InChIKey | GFVBMYXSJREXBU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|