C20H38 — CID 5352800
(3E)-3,7,11,15-tetramethylhexadeca-1,3-diene (PubChem CID 5352800) has the molecular formula C20H38 and a molecular weight of 278.52 g/mol. Its IUPAC name is (3E)-3,7,11,15-tetramethylhexadeca-1,3-diene.
| Compound Name | (3E)-3,7,11,15-tetramethylhexadeca-1,3-diene |
|---|---|
| PubChem CID | 5352800 |
| Molecular Formula | C20H38 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 278.30 |
| IUPAC Name | (3E)-3,7,11,15-tetramethylhexadeca-1,3-diene |
| SMILES | C=C/C(C)=C/CCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H38/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3/h7,12,17,19-20H,1,8-11,13-16H2,2-6H3/b18-12+ |
| InChIKey | HNTNJYMWJHGCBD-LDADJPATSA-N |
| XLogP | 7.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|