About methyl (Z)-2-chlorobut-2-enoate
methyl (Z)-2-chlorobut-2-enoate (PubChem CID 5352850) has the molecular formula C5H7ClO2
and a molecular weight of 134.56 g/mol. Its IUPAC name is methyl (Z)-2-chlorobut-2-enoate.
Molecular Properties
| Compound Name | methyl (Z)-2-chlorobut-2-enoate |
| PubChem CID | 5352850 |
| Molecular Formula | C5H7ClO2 |
| Molecular Weight | 134.56 g/mol |
| Exact Mass | 134.01 |
| IUPAC Name | methyl (Z)-2-chlorobut-2-enoate |
| SMILES | C/C=C(\Cl)C(=O)OC |
| InChI | InChI=1S/C5H7ClO2/c1-3-4(6)5(7)8-2/h3H,1-2H3/b4-3- |
| InChIKey | NTMJDABWJARASG-ARJAWSKDSA-N |
| XLogP | 1.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.56 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-2-chlorobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-2-chlorobut-2-enoate?
The IUPAC name of methyl (Z)-2-chlorobut-2-enoate (CID 5352850) is methyl (Z)-2-chlorobut-2-enoate.
What is the SMILES notation for methyl (Z)-2-chlorobut-2-enoate?
The canonical SMILES for methyl (Z)-2-chlorobut-2-enoate is C/C=C(\Cl)C(=O)OC.
What is the InChIKey of methyl (Z)-2-chlorobut-2-enoate?
The InChIKey is NTMJDABWJARASG-ARJAWSKDSA-N. The full InChI is InChI=1S/C5H7ClO2/c1-3-4(6)5(7)8-2/h3H,1-2H3/b4-3-.
What are the key properties of methyl (Z)-2-chlorobut-2-enoate?
methyl (Z)-2-chlorobut-2-enoate has a molecular weight of 134.56 g/mol, XLogP of 1.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-2-chlorobut-2-enoate is sourced from PubChem (CID 5352850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).