C15H24 — CID 535294
2,2,5,5,8,8-hexamethyltricyclo[4.3.0.07,9]non-3-ene (PubChem CID 535294) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 2,2,5,5,8,8-hexamethyltricyclo[4.3.0.07,9]non-3-ene.
| Compound Name | 2,2,5,5,8,8-hexamethyltricyclo[4.3.0.07,9]non-3-ene |
|---|---|
| PubChem CID | 535294 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 2,2,5,5,8,8-hexamethyltricyclo[4.3.0.07,9]non-3-ene |
| SMILES | CC1(C)C=CC(C)(C)C2C1C1C2C1(C)C |
| InChI | InChI=1S/C15H24/c1-13(2)7-8-14(3,4)10-9(13)11-12(10)15(11,5)6/h7-12H,1-6H3 |
| InChIKey | JKMRUZRVAKMLSX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|